| Identification | |
| Name: | 1,3,5-Triazine-2,4-diamine,6-chloro-N2-ethyl-N4-(1-methylpropyl)- |
| Synonyms: | 1,3,5-Triazine-2,4-diamine,6-chloro-N-ethyl-N'-(1-methylpropyl)- (9CI); s-Triazine, 2-(sec-butylamino)-4-chloro-6-(ethylamino)-(7CI,8CI); 2-Chloro-4-ethylamino-6-sec-butylamino-1,3,5-triazine;2-Chloro-4-ethylamino-6-sec-butylamino-s-triazine;6-(sec-Butylamino)-2-chloro-4-(ethylamino)-s-triazine;6-Chloro-N2-ethyl-N4-(1-methylpropyl)-1,3,5-triazine-2,4-diamine;Ethylamino-sec-butylaminochloro-s-triazine; GS 13528; Sebuthylazine;sec-Butylazine |
| CAS: | 7286-69-3 |
| EINECS: | 230-710-8 |
| Molecular Formula: | C9H16 Cl N5 |
| Molecular Weight: | 229.75 |
| InChI: | InChI=1/C9H16ClN5/c1-4-6(3)12-9-14-7(10)13-8(15-9)11-5-2/h6H,4-5H2,1-3H3,(H2,11,12,13,14,15) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1648 3/PG 2 |
| Flash Point: | 2 °C |
| Boiling Point: | 380°C at 760 mmHg |
| Density: | 1.232g/cm3 |
| Refractive index: | 1.592 |
| Specification: | Safety Statements:16-26-36 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 2 °C |
| Storage Temperature: | APPROX 4°C |
| Safety Data | |
 |
|
