| Identification |
| Name: | Imidazo[2,1-b]thiazole,6-(4-fluorophenyl)-2,3-dihydro-5-(4-pyridinyl)- |
| Synonyms: | SKF 86002 |
| CAS: | 72873-74-6 |
| Molecular Formula: | C16H12 F N3 S |
| Molecular Weight: | 370.27 |
| InChI: | InChI=1/C16H12FN3S.2ClH/c17-13-3-1-11(2-4-13)14-15(12-5-7-18-8-6-12)20-9-10-21-16(20)19-14;;/h1-8H,9-10H2;2*1H |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 189-190 °C(lit.)
|
| Flash Point: | 241.7°C |
| Boiling Point: | 476.1°C at 760 mmHg |
| Biological Activity: | Inhibitor of p38 MAP kinase (IC 50 = 0.1-1 μ M). Potently inhibits LPS-induced IL-1 and TNF- α production in human monocytes (IC 50 = 1 μ M). Also inhibits 5-lipoxygenase- and cyclooxygenase-mediated arachidonic acid metabolism in RBL-1 cells (IC 50 values are 10 and 100 μ M respectively). Anti-inflammatory following oral administration in vivo . |
| Flash Point: | 241.7°C |
| Storage Temperature: | 2-8°C |
| Color: | off-white |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
