| Identification | |
| Name: | 3'-deoxyadenosine |
| Synonyms: | cordycepin crystalline; Cordycepin |
| CAS: | 73-03-0 |
| EINECS: | 200-791-4 |
| Molecular Formula: | C10H13N5O3 |
| Molecular Weight: | 251.24 |
| InChI: | InChI=1/C10H13N5O3/c11-8-7-9(13-3-12-8)15(4-14-7)10-6(17)1-5(2-16)18-10/h3-6,10,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,10+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.91 g/cm3 |
| Refractive index: | 1.863 |
| Appearance: | Crystalline Solid |
| Specification: |
Cordycepin , with CAS number of 73-03-0, can be called 9H-Purin-6-amine, 9-(3-deoxy-.beta.-D-erythro-pentofuranosyl)- ; 9H-Purine, 6-amino-9-(3-deoxy-.beta.-D-ribofuranosyl)- ; Cordycepin ; 2'-Hydroxy-3'-deoxyadenosine erythro ; 3'-Deoxyadenosine . It is a crystalline solid. Cordycepin (CAS NO.73-03-0) is the first reported in nucleoside antibiotic. |
| Report: |
EPA Genetic Toxicology Program. |
| HS Code: | 29349990 |
| Biological Activity: | Nucleoside analog that acts as an anticancer and antifungal agent. Can be converted to 3'-deoxyadenosine triphosphate (3'-dATP), which inhibits ATP-dependent DNA synthesis. Inhibits growth of various tumor cells in vitro . |
| Usage: | First reported nucleoside antibiotic. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
