| Identification | |
| Name: | Melatonine |
| Synonyms: | N-(2-(5-Methoxy-1H-indol-3-yl)ethyl)acetamide;N-Acetyl-5-methoxytryptamine;5-Methoxy-N-acetyltryptamine;Acetamide, N-(2-(5-methoxyindol-3-yl)ethyl)-;acetamide, N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-;N-(2-(5-Methoxyindol-3-yl)ethyl)acetamide;Acetamide, N-[2-(5-methoxyindol-3-yl)ethyl]- (6CI,8CI);Melovine;Acetamide, N-[2- (5-methoxy-1H-indol-3-yl)ethyl]-;Melatonin;Acetamide, {N-[2-(5-methoxyindol-3-yl)ethyl]-};Circadin;Acetamide,N-[2-(5-methoxy-1H-indol-3-yl)- ethyl]-;Prestwick_312;Acetamide, N-[2-(5-methoxy-1H-indol-3-yl)ethyl]- (9CI);Melatonin (MLT); |
| CAS: | 73-31-4 |
| EINECS: | 200-797-7 |
| Molecular Formula: | C13H16N2O2 |
| Molecular Weight: | 232.31 g/mol |
| InChI: | InChI=1S/C13H16N2O2/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.175 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Insoluble |
| Appearance: | White crystalline powder |
| Specification: |
?Melatonin ,?with a?CAS number of?73-31-4,?also known as?N-(2-(5-methoxyindol-3-yl)ethyl)acetamide ; N-Acetyl-5-methoxytryptamine ; and?3-(N-Acetyl-2-aminoethyl)-5-methoxyindole. It?is a naturally occurring hormone found in animals and in some other living organisms, including algae.?Antioxidants; Central Nervous System Agents;?Central Nervous System;?Depressants; Drug / Therapeutic Agent;?Hormone; Mutation data;?Protective Agents;?Reproductive Effect and Tumor data. |
| HS Code: | 29379000 |
| Biological Activity: | Endogenous hormone that acts as an agonist at melatonin receptors MT 1 and MT 2 . Exhibits a prominent role in the control of circadian rhythm, displays immunomodulatory activity and acts as a powerful antioxidant in vivo . |
| Usage: | Hormone postulated to mediate photoperiodicity in mammals. Inhibits cerebellar nitric oxide synthetase |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
