| Identification | |
| Name: | Aziridine,2-(phenylmethyl)-, (2S)- |
| Synonyms: | Aziridine,2-(phenylmethyl)-, (S)-; |
| CAS: | 73058-30-7 |
| Molecular Formula: | C9H11N |
| Molecular Weight: | 133.1903 |
| InChI: | InChI=1/C9H11N/c1-2-4-8(5-3-1)6-9-7-10-9/h1-5,9-10H,6-7H2/t9-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.044 g/cm3 |
| Refractive index: | 1.568 |
| Specification: |
The (S)-2-Benzylaziridine with its cas register number is 73058-30-7. It also can be called as Aziridine,2-(phenylmethyl)-, (2S)- and the Systematic name about this chemical is (2S)-2-benzylaziridine. Physical properties about (S)-2-Benzylaziridine are: (1)ACD/LogP: 1.25; (2)ACD/LogD (pH 5.5): -1; (3)ACD/LogD (pH 7.4): 1; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 21; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Polar Surface Area: 21.94Å2; (12)Index of Refraction: 1.568; (13)Molar Refractivity: 41.738 cm3; (14)Molar Volume: 127.574 cm3; (15)Polarizability: 16.546x10-24cm3; (16)Surface Tension: 41.596 dyne/cm; (17)Enthalpy of Vaporization: 44.082 kJ/mol; (18)Vapour Pressure: 0.261 mmHg at 25°C You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
