| Identification | |
| CAS: | 73086-97-2 |
| EINECS: | 277-280-8 |
| Molecular Formula: | C9H12BrNO3 |
| Molecular Weight: | 276.12706 |
| InChI: | InChI=1/C10H13NO3.BrH/c12-10(13)11-14-8-4-7-9-5-2-1-3-6-9;/h1-3,5-6,11H,4,7-8H2,(H,12,13);1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.249 g/cm3 |
| Appearance: | White Powder |
| Specification: | White Powder usageEng:Useful intermediate for the synthesis of optically active amino acids |
| Storage Temperature: | -20?C Freezer |
| Usage: | Useful intermediate for the synthesis of optically active amino acids |
| Safety Data | |
 |
|
