| Identification | |
| Name: | 2H-Tetrazole,5-(2-iodophenyl)- |
| Synonyms: | 1H-Tetrazole,5-(2-iodophenyl)- (9CI); 5-(2-Iodophenyl)-1H-tetrazole;5-(o-Iodophenyl)tetrazole |
| CAS: | 73096-40-9 |
| Molecular Formula: | C7H5 I N4 |
| Molecular Weight: | 272.05 |
| InChI: | InChI=1/C7H5IN4/c8-6-4-2-1-3-5(6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 197.64°C |
| Boiling Point: | 403.187°C at 760 mmHg |
| Density: | 2.018g/cm3 |
| Refractive index: | 1.706 |
| Specification: |
5-(2-Iodophenyl)-1H-tetrazole , with CAS number of 73096-40-9, can be called 1H-tetrazole, 5-(2-iodophenyl)- . |
| Flash Point: | 197.64°C |
| Safety Data | |
 |
|
