| Identification | |
| Name: | 5-Bromothiophene-2-carboxylic acid |
| Synonyms: | 5-Bromo-2-thiophenecarboxylic acid |
| CAS: | 7311-63-9 |
| EINECS: | -0 |
| Molecular Formula: | C5H3BrO2S |
| Molecular Weight: | 207.04 |
| InChI: | InChI=1/C5H3BrO2S/c6-4-1-3(2-9-4)5(7)8/h1-2H,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.923 g/cm3 |
| Refractive index: | 1.65 |
| Appearance: | white powder |
| Specification: | White to light yellow crystal powder usageEng:A thiophene derivative with genotoxicity Safety Statements:26-36/37/39-22-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 22:Do not breathe dust 36:Wear suitable protective clothing |
| Usage: | A thiophene derivative with genotoxicity |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
