| Identification | |
| Name: | Dicyclopropylamine |
| Synonyms: | Di(cyclopropyl)amine |
| CAS: | 73121-95-6 |
| Molecular Formula: | C6H11N |
| Molecular Weight: | 97.16 |
| InChI: | InChI=1/C6H11N/c1-2-5(1)7-6-3-4-6/h5-7H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.98 |
| Refractive index: | 1.505 |
| Specification: |
The Dicyclopropylamine, with cas registry number 73121-95-6, has the systematic name of N-cyclopropylcyclopropanamine. And the chemical formula of this chemical is C6H11N. Physical properties about this chemical are: (1)ACD/LogP: 0.42; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 1; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 12.03 Å2; (11)Index of Refraction: 1.505; (12)Molar Refractivity: 29.343 cm3; (13)Molar Volume: 98.996 cm3; (14)Polarizability: 11.632×10-24cm3; (15)Surface Tension: 31.961 dyne/cm; (16)Enthalpy of Vaporization: 37.313 kJ/mol; (17)Vapour Pressure: 7.626 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
