Identification |
Name: | Fatty acids,montan-wax, ethylene esters |
Synonyms: | Fattyacids, montan-wax, esters with ethylene glycol; Montan wax carboxy acids, ethyleneesters; Montan wax, acids, esters with ethylene glycol |
CAS: | 73138-45-1 |
EINECS: | 277-291-8 |
Molecular Formula: | C30H60O3 |
Molecular Weight: | 0 |
InChI: | InChI=1/C30H60O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-30(32)33-29-28-31/h31H,2-29H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 200.6°C |
Boiling Point: | 562.1°C at 760 mmHg |
Density: | 0.893g/cm3 |
Refractive index: | 1.462 |
Flash Point: | 200.6°C |
Safety Data |
|
 |