| Identification | |
| Name: | 4-Thiazoleacetic acid,2-amino-a-oxo- |
| Synonyms: | (2-Amino-4-thiazolyl)glyoxylicacid;2-(2-Aminothiazol-4-yl)glyoxylic acid;2-Amino-4-thiazoleglyoxylic acid;2-Amino-a-oxo-4-thiazoleacetic acid; |
| CAS: | 73150-67-1 |
| EINECS: | 277-301-0 |
| Molecular Formula: | C5H4N2O3S |
| Molecular Weight: | 172.16 |
| InChI: | InChI=1/C5H4N2O3S/c6-5-7-2(1-11-5)3(8)4(9)10/h1H,(H2,6,7)(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.711 g/cm3 |
| Refractive index: | 1.693 |
| Specification: |
The 2-(2-Aminothiazol-4-yl)glyoxylic acid, with the CAS registry number 73150-67-1, has the IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid. As to its usage, it is usually used as the intermediates of cephalosporins drugs, with the product categories including organic acids. The physical properties of this chemical are as follows: (1)ACD/LogP: -0.57; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 5; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 121.52; (11)Index of Refraction: 1.693; (12)Molar Refractivity: 38.557 cm3; (13)Molar Volume: 100.573 cm3; (14)Polarizability: 15.285×10-24 cm3; (15)Surface Tension: 99.187 dyne/cm; (16)Density: 1.712 g/cm3; (17)Flash Point: 193.137 °C; (18)Enthalpy of Vaporization: 68.123 kJ/mol; (19)Boiling Point: 395.74 °C at 760 mmHg; (20)Exact Mass: 171.994263; (21)MonoIsotopic Mass: 171.994263; (22)Topological Polar Surface Area: 122; (23)Heavy Atom Count: 11; (24)Complexity: 196. Additionally, you could obtain the molecular structure by converting the following datas: |
| Safety Data | |
 |
|
