| Identification | |
| Name: | Benzamide,4-(4-oxocyclohexyl)- |
| Synonyms: | 4-Benzoylamino cyclohexanone |
| CAS: | 73204-06-5 |
| Molecular Formula: | C13H15NO2 |
| Molecular Weight: | 217.26 |
| InChI: | InChI=1/C13H15NO2/c15-12-8-6-11(7-9-12)14-13(16)10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,14,16) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.15 g/cm3 |
| Refractive index: | 1.559 |
| Specification: |
The cas register number of 4-Benzamido-cyclohexanone is 73204-06-5. It also can be called as benzamide, N-(4-oxocyclohexyl)- and the Systematic name about this chemical is N-(4-oxocyclohexyl)benzamide. Physical properties about 4-Benzamido-cyclohexanone are: (1)ACD/LogP: 0.89 ; (2)# of Rule of 5 Violations: 0 ; (3)ACD/LogD (pH 5.5): 0.89 ; (4)ACD/LogD (pH 7.4): 0.89 ; (5)ACD/BCF (pH 5.5): 2.81; (6)ACD/BCF (pH 7.4): 2.81; (7)ACD/KOC (pH 5.5): 72.85; (8)ACD/KOC (pH 7.4): 72.85; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 46.17Å2; (13)Index of Refraction: 1.559; (14)Molar Refractivity: 60.98 cm3; (15)Molar Volume: 188.8 cm3; (16)Surface Tension: 45.7 dyne/cm; (17)Density: 1.15 g/cm3; (18)Flash Point: 189.3 °C; (19)Enthalpy of Vaporization: 70.47 kJ/mol; (20)Boiling Point: 446.5 °C at 760 mmHg; (21)Vapour Pressure: 3.62E-08 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
