| Identification | |
| Name: | Benzeneacetic acid, a-(acetyloxy)-, (aS)- |
| Synonyms: | Benzeneaceticacid, a-(acetyloxy)-, (S)-; Mandelicacid, acetate, L- (8CI); (+)-O-Acetylmandelic acid; (2S)-2-Acetyloxy-2-phenylaceticacid; (S)-(+)-O-Acetyl-L-mandelic acid; (S)-(+)-O-Acetylmandelic acid; (S)-(+)-a-Acetoxyphenylacetic acid;(S)-2-Acetoxy-2-phenylacetic acid; (S)-O-Acetylmandelic acid;L-(+)-O-Acetylmandelic acid; L-O-Acetylmandelic acid; S-Acetylmandelic acid |
| CAS: | 7322-88-5 |
| Molecular Formula: | C10H10O4 |
| Molecular Weight: | 194.18 |
| InChI: | InChI=1/C10H10O4/c1-6(11)7-4-2-3-5-8(7)9(12)10(13)14/h2-5,9,12H,1H3,(H,13,14)/t9-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 212°C |
| Boiling Point: | 403.6°C at 760 mmHg |
| Density: | 1.324g/cm3 |
| Refractive index: | 153 ° (C=2, Acetone) |
| Alpha: | 153 º (C=2 IN ACETONE) |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powde Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Flash Point: | 212°C |
| Storage Temperature: | Refrigerator |
| Safety Data | |
 |
|
