| Identification | |
| Name: | Imidazo[1,2-a]pyridin-8-amine |
| Synonyms: | Imidazo[1,2-a]pyridin-8-ylamine; |
| CAS: | 73221-18-8 |
| Molecular Formula: | C7H7N3 |
| Molecular Weight: | 133.15 |
| InChI: | InChI=1/C7H7N3/c8-6-2-1-4-10-5-3-9-7(6)10/h1-5H,8H2 |
| Molecular Structure: | ![(C7H7N3) Imidazo[1,2-a]pyridin-8-ylamine;](https://img1.guidechem.com/chem/e/dict/134/73221-18-8.jpg) |
| Properties | |
| Density: | 1.328 g/cm3 |
| Refractive index: | 1.697 |
| Specification: |
The Imidazo[1,2-a]pyridin-8-amine, with the CAS registry number 73221-18-8, is also called Imidazo[1,2-a]pyridin-8-ylamine. And the molecular formula of the chemical is C7H7N3. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.30; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 0; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 20; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 1; (11)Polar Surface Area: 43.32 Å2; (12)Index of Refraction: 1.697; (13)Molar Refractivity: 38.628 cm3; (14)Molar Volume: 100.293 cm3; (15)Polarizability: 15.313×10-24cm3; (16)Surface Tension: 57.404 dyne/cm; (17)Density: 1.328 g/cm3. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
