| Identification | |
| Name: | L-Alaninamide |
| Synonyms: | N-ACETYL-L-ALANINE AMIDE; (S)-2-Amino-propionamide; L-Alaninamide; (2S)-2-Aminopropionamide; Alaninamide; (S)-(+)-2-Aminopropanamide |
| CAS: | 7324-05-2 |
| Molecular Formula: | C3H8N2O |
| Molecular Weight: | 88.11 |
| InChI: | InChI=1/C3H8N2O/c1-2(4)3(5)6/h2H,4H2,1H3,(H2,5,6)/t2-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 103.4°C |
| Boiling Point: | 247.4°C at 760 mmHg |
| Density: | 1.062g/cm3 |
| Refractive index: | 1.467 |
| Specification: |
The L-Alaninamide with the CAS number 7324-05-2 is also called Propanamide, 2-amino-,(2S)-. The IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl]azanium. Its molecular formula is C3H8N2O. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the L-Alaninamide are: (1)ACD/LogP: -1.63; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 3; (8)#H bond donors: 4; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 23.55 Å2; (11)Index of Refraction: 1.467; (12)Molar Refractivity: 23 cm3; (13)Molar Volume: 82.9 cm3; (14)Polarizability: 9.12×10-24cm3; (15)Surface Tension: 42.7 dyne/cm; (16)Enthalpy of Vaporization: 48.46 kJ/mol; (17)Vapour Pressure: 0.0257 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 103.4°C |
| Safety Data | |
 |
|
