| Identification | |
| Name: | 191942-64-0 |
| Synonyms: | Isooctadecanoic acid, ester with oxybis[propanediol];POLYGLYCERYL-2 ISOSTEARATE;Isooctadecansure, Ester mit Oxybis[propandiol];diglyceryl isostearate |
| CAS: | 73296-86-3 |
| EINECS: | 277-361-8 |
| Molecular Formula: | C24H50O7 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C18H36O2.C6H14O5/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;7-1-5(9)3-11-4-6(10)2-8/h17H,3-16H2,1-2H3,(H,19,20);5-10H,1-4H2 |
| Molecular Structure: | ![(C24H50O7) Isooctadecanoic acid, ester with oxybis[propanediol];POLYGLYCERYL-2 ISOSTEARATE;Isooctadecansure, Es...](https://img1.guidechem.com/chem/e/dict/24/3037295.png) |
| Properties | |
| Flash Point: | 225.7°C |
| Boiling Point: | 400.8°C at 760 mmHg |
| Flash Point: | 225.7°C |
| Safety Data | |
 |
|
