| Identification | |
| Name: | Butanoic acid,2-hydroxy-, methyl ester, (2S)- |
| Synonyms: | Butanoicacid, 2-hydroxy-, methyl ester, (S)-; (S)-2-Hydroxybutyric acid methyl ester;Methyl (2S)-hydroxybutyrate; Methyl (S)-b-hydroxybutyrate |
| CAS: | 73349-08-3 |
| Molecular Formula: | C5H10 O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H10O3/c1-3-4(6)5(7)8-2/h4,6H,3H2,1-2H3/t4-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 54.62°C |
| Boiling Point: | 159.279°C at 760 mmHg |
| Density: | 1.051g/cm3 |
| Refractive index: | 1.42 |
| Specification: |
The (S)-Methyl-2-hydroxybutanoate with the CAS number 73349-08-3 is also called Butanoicacid, 2-hydroxy-, methyl ester, (S)-. Its molecular formula is C5H10O3. This chemical belongs to the following product categories: (1)Alcohols, Hydroxy Esters and Derivatives; (2)Chiral Compounds. The properties of the chemical are: (1)ACD/LogP: -0.04; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 46.53 Å2; (7)Index of Refraction: 1.42; (8)Molar Refractivity: 28.482 cm3; (9)Molar Volume: 112.434 cm3; (10)Polarizability: 11.291×10-24cm3; (11)Surface Tension: 33.218 dyne/cm; (12)Enthalpy of Vaporization: 46.109 kJ/mol; (13)Vapour Pressure: 0.889 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 54.62°C |
| Safety Data | |
 |
|
