Identification |
Name: | Benzoic acid,2-chloro-, ethyl ester |
Synonyms: | Benzoicacid, o-chloro-, ethyl ester (6CI,7CI,8CI); 2-Chlorobenzoic acid ethyl ester;Ethyl 2-chlorobenzoate; Ethyl o-chlorobenzoate |
CAS: | 7335-25-3 |
EINECS: | 230-842-6 |
Molecular Formula: | C9H9 Cl O2 |
Molecular Weight: | 184.62 |
InChI: | InChI=1/C9H9ClO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
Molecular Structure: |
|
Properties |
Flash Point: | >230 °F |
Boiling Point: | 241-243 °C(lit.) |
Density: | 1.194 |
Refractive index: | n20/D 1.523(lit.) |
Specification: | Clear colorless to pale yellow liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | >230 °F |
Safety Data |
|
|