| Identification | |
| Name: | Benzeneacetaldehyde,4-hydroxy- |
| Synonyms: | Acetaldehyde,(p-hydroxyphenyl)- (6CI,7CI,8CI);(p-Hydroxyphenyl)acetaldehyde;4-Hydroxyphenylacetaldehyde; |
| CAS: | 7339-87-9 |
| Molecular Formula: | C8H8O2 |
| Molecular Weight: | 136.15 |
| InChI: | InChI=1/C8H8O2/c9-6-5-7-1-3-8(10)4-2-7/h1-4,6,10H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.153 g/cm3 |
| Refractive index: | 1.554 |
| Specification: | Pale Yellow Liquid usageEng:An intermediate in the metabolic pathway in yeast. This compound contains p-Hydroxybenzaldehyde. |
| Storage Temperature: | -20?C Freezer |
| Usage: | An intermediate in the metabolic pathway in yeast |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
