| Identification | |
| Name: | Allyl phenyl thiourea |
| Synonyms: | 1-allyl-3-phenyl-2-thiourea;1-Allyl-3-phenylthiourea |
| CAS: | 7341-63-1 |
| EINECS: | 230-855-7 |
| Molecular Formula: | C10H12N2S |
| Molecular Weight: | 192.28068 |
| InChI: | InChI=1/C10H12N2S/c1-2-8-11-10(13)12-9-6-4-3-5-7-9/h2-7H,1,8H2,(H2,11,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 124.4°C |
| Boiling Point: | 282.1°C at 760 mmHg |
| Density: | 1.149g/cm3 |
| Refractive index: | 1.641 |
| Specification: |
Allyl phenyl thiourea with cas registry number of 7341-63-1 is also known as 1-Allyl-3-phenyl-2-thiourea ; Allyl phenyl thiourea ; N-Allyl-N'-phenylthiourea ; 1-Allyl-3-phenyl-2-thiourea ; Thiourea, N-phenyl-N'-2-propenyl- ; Urea, 1-allyl-3-phenyl-2-thio- . It would emit very toxic fumes when heated to decomposition , so it should be stored in dry and cool place . Allyl phenyl thiourea with cas registry number of 7341-63-1 is used as a intermediate. |
| Flash Point: | 124.4°C |
| Safety Data | |
 |
|
