| Identification | |
| Name: | 2-Propynamide (9CI) |
| Synonyms: | Propiolamide(6CI,7CI,8CI);NSC 520954;Propiolic acid amide; |
| CAS: | 7341-96-0 |
| Molecular Formula: | C3H3NO |
| Molecular Weight: | 69.06 |
| InChI: | InChI=1/C3H3NO/c1-2-3(4)5/h1H,(H2,4,5) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.102 g/cm3 |
| Refractive index: | 1.465 |
| Appearance: | Waxy Yellow Solid |
| Specification: |
The Propiolamide with the cas number 7341-96-0 is also called Propiolic acid amide. Both the systematic name and IUPAC name are prop-2-ynamide. Its molecular formula is C3H3NO. The product's category is Miscellaneous Reagents. This chemical is waxy yellow solid. The properties of the chemical are: (1)ACD/LogP: -0.08; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.08; (4)ACD/LogD (pH 7.4): -0.08; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 21.67; (8)ACD/KOC (pH 7.4): 21.67; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 20.31Å2; (13)Index of Refraction: 1.465; (14)Molar Refractivity: 17.34 cm3; (15)Molar Volume: 62.6 cm3; (16)Polarizability: 6.87×10-24cm3; (17)Surface Tension: 47.7 dyne/cm; (18)Enthalpy of Vaporization: 37.21 kJ/mol; (19)Vapour Pressure: 8.03 mmHg at 25°C. Preparation: This chemical can be prepared by propynoic acid methyl ester. This reaction needs reagent NH4OH at temperature of -30°C. The reaction time is 20 min. The yield is 94%. Uses: This chemical can prepare propynenitrile. This reaction needs reagent P2O5 at temperature of 120 °C. The yield is 61%. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
