Identification |
Name: | Benzo[b]thiophene,3-bromo- |
Synonyms: | Thianaphthene,3-bromo- (5CI); 3-Bromo-1-benzothiophene; 3-Bromobenzo[b]thiophene;3-Bromobenzothiophene; 3-Bromothianaphthene; 3-Bromothionaphthene |
CAS: | 7342-82-7 |
Molecular Formula: | C8H5 Br S |
Molecular Weight: | 213.09 |
InChI: | InChI=1/C8H5BrS/c9-7-5-10-8-4-2-1-3-6(7)8/h1-5H |
Molecular Structure: |
![(C8H5BrS) Thianaphthene,3-bromo- (5CI); 3-Bromo-1-benzothiophene; 3-Bromobenzo[b]thiophene;3-Bromobenzothiophe...](https://img1.guidechem.com/chem/e/dict/31/7342-82-7.jpg) |
Properties |
Flash Point: | >230 °F |
Boiling Point: | 269 ºC |
Density: | 1.629 |
Refractive index: | 1.668 |
Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | >230 °F |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |