| Identification | |
| Name: | 2-Pyrimidinamine,4-chloro-6-(1-methylethyl)- |
| Synonyms: | 2-Amino-4-chloro-6-isopropylpyrimidine;4-Chloro-6-isopropylpyrimidin-2-amine |
| CAS: | 73576-33-7 |
| Molecular Formula: | C7H10 Cl N3 |
| Molecular Weight: | 171.63 |
| InChI: | InChI=1/C7H10ClN3/c1-4(2)5-3-6(8)11-7(9)10-5/h3-4H,1-2H3,(H2,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 139.359°C |
| Boiling Point: | 306.818°C at 760 mmHg |
| Density: | 1.224g/cm3 |
| Refractive index: | 1.566 |
| Specification: |
The extinguishing agent of 2-Amino-4-chloro-6-isopropylpyrimidine (CAS No.73576-33-7) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 139.359°C |
| Safety Data | |
 |
|
