| Identification | |
| Name: | Urea,N-ethyl-N'-(3-methyl-2-thiazolidinylidene)- |
| Synonyms: | Urea,ethyl(3-methyl-2-thiazolidinylidene)- (9CI) |
| CAS: | 73696-65-8 |
| Molecular Formula: | C7H13 N3 O S |
| Molecular Weight: | 187.29 |
| InChI: | InChI=1/C7H13N3OS/c1-3-8-6(11)9-7-10(2)4-5-12-7/h3-5H2,1-2H3,(H,8,11)/b9-7- |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.274g/cm3 |
| Refractive index: | 1.605 |
| Specification: |
N-Ethyl-N'-(3-methyl-2-thiazolidinylidene)urea , its cas register number is 73696-65-8. It also can be called BRN 5933759 ; Urea, 1-ethyl-3-(3-methyl-2-thiazolidinylidene)- .When heated to decomposition it emits very toxic fumes of SOx and NOx. |
| Safety Data | |
 |
|
