| Identification | |
| Name: | Phenol,2,4,6-trinitro-, sodium salt, hydrate (1:1:1) |
| Synonyms: | Phenol,2,4,6-trinitro-, sodium salt, monohydrate (9CI); Sodium picrate monohydrate |
| CAS: | 73771-13-8 |
| Molecular Formula: | C6H3 N3 O7 . H2 O . Na |
| Molecular Weight: | 251.09 |
| InChI: | InChI=1/C6H3N3O7.Na.H2O/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;;/h1-2,10H;;1H2/q;+1;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 133.9°C |
| Boiling Point: | 303.6°C at 760 mmHg |
| Specification: |
Sodium picrate monohydrate (CAS NO.73771-13-8) is also called Phenol, 2,4,6-trinitro-, sodium salt, hydrate ; Picric acid, sodium salt, hydrate . Sodium picrate monohydrate (CAS NO.73771-13-8) is moderate toxic. It will produce toxic nitrogen oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. Keep Sodium picrate monohydrate (CAS NO.73771-13-8) separate from oxidants and acids. |
| Flash Point: | 133.9°C |
| Safety Data | |
 |
|
