| Identification |
| Name: | dimethyl(octyl)amine |
| Synonyms: | n,n-dimethyloctylamine; N,N-dimethyl-1-Octanamine; Octyl dimethyl amine |
| CAS: | 7378-99-6 |
| EINECS: | 230-939-3 |
| Molecular Formula: | C10H23N |
| Molecular Weight: | 157.3 |
| InChI: | InChI=1/C10H23N/c1-4-5-6-7-8-9-10-11(2)3/h4-10H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2922 |
| Density: | 0.765 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4233-1.4253 |
| Water Solubility: | slightly soluble |
| Solubility: | Soluble |
| Appearance: | clear liquid |
| Packinggroup: | III |
| HS Code: | 29211980 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Barlene(R) 8S is a tertiary amine used typically as an intermediate in the manufacture of quaternary ammonium compounds. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
