| Identification | |
| Name: | Dihydroxo(1,2-diaminocyclohexane)platinum(II) dihydrate |
| CAS: | 73825-87-3 |
| Molecular Formula: | C6H16N2O2Pt . 2H2O |
| Molecular Weight: | 379.318 |
| InChI: | InChI=1/C6H14N2.4H2O.Pt/c7-5-3-1-2-4-6(5)8;;;;;/h5-6H,1-4,7-8H2;4*1H2;/q;;;;;+2/p-2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 75°C |
| Boiling Point: | 193.6°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Dihydroxo(1,2-diaminocyclohexane)platinum(II) dihydrate , its cas register number is 73825-87-3. It also can be called NSC 268252 ; and Platinum (II), (cyclohexane-1,2-diammine)dihydroxo-, dihydrate . |
| Flash Point: | 75°C |
| Safety Data | |
 |
|
