| Identification | |
| Name: | Dibenzylethylsulfonium iodide mercuric iodide |
| CAS: | 73926-81-5 |
| Molecular Formula: | C16H19HgI3S |
| Molecular Weight: | 824.6905 |
| InChI: | InChI=1/C16H19S.Hg.3HI/c1-2-17(13-15-9-5-3-6-10-15)14-16-11-7-4-8-12-16;;;;/h3-12H,2,13-14H2,1H3;;3*1H/q+1;+2;;;/p-3 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
Dibenzylethylsulfonium iodide mercuric iodide ,its CAS NO. is 73926-81-5,the synonyms is Sulfonium, dibenzylethyl-, iodide, compd. with mercury iodide (1:1) . |
| Report: |
Mercury and its compounds are on the Community Right-To-Know List. |
| Safety Data | |
 |
|
