| Identification | |
| Name: | Chloro(2-(3-methoxypropionamido)cyclohexyl)mercury |
| CAS: | 73926-89-3 |
| Molecular Formula: | C10H18ClHgNO2 |
| Molecular Weight: | 420.2984 |
| InChI: | InChI=1/C10H18NO2.ClH.Hg/c1-13-8-7-10(12)11-9-5-3-2-4-6-9;;/h5,9H,2-4,6-8H2,1H3,(H,11,12);1H;/q;;+1/p-1/rC10H18ClHgNO2/c1-15-7-6-10(14)13-9-5-3-2-4-8(9)12-11/h8-9H,2-7H2,1H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Chloro(2-(3-methoxypropionamido)cyclohexyl)mercury , its cas register number is 73926-89-3. It also can be called Propionamide, N-(2-chloromercuricyclohexyl)- ; and Mercury, chloro(2-(3-methoxypropionamido)cyclohexyl)- . Its classification code is Organometallic. |
| Report: |
Mercury and its compounds are on the Community Right-To-Know List. |
| Flash Point: | °C |
| Safety Data | |
 |
|
