| Identification | |
| Name: | D-Alanine,3-(diethylamino)- |
| Synonyms: | 3-(Diethylamino)-D-alanine;D-alanine, 3-(diethylamino)-;3-(N,N-Diethylamino)-D-alanine; |
| CAS: | 739363-49-6 |
| Molecular Formula: | C7H16N2O2 |
| Molecular Weight: | 160.21 |
| InChI: | InChI=1/C7H16N2O2/c1-3-9(4-2)5-6(8)7(10)11/h6H,3-5,8H2,1-2H3,(H,10,11)/t6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.067 g/cm3 |
| Refractive index: | 1.488 |
| Specification: |
The 3-(N,N-Diethylamino)-D-alanine, with the cas registry number 739363-49-6, has the systematic name of D-alanine, 3-(diethylamino)-. It belongs to the following product categories: Aminetertiary; Glycinescaffold; Amino Acids. And the molecular formula of the chemical is C7H16N2O2. The characteristics of this chemical are as followings: (1)ACD/LogP: 0.51; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 4; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 6; (10)Polar Surface Area: 66.56 Å2; (11)Index of Refraction: 1.488; (12)Molar Refractivity: 43.25 cm3; (13)Molar Volume: 150 cm3; (14)Polarizability: 17.14×10-24cm3; (15)Surface Tension: 43.1 dyne/cm; (16)Density: 1.067 g/cm3; (17)Flash Point: 103 °C; (18)Enthalpy of Vaporization: 53.29 kJ/mol; (19)Boiling Point: 246.8 °C at 760 mmHg; (20)Vapour Pressure: 0.00861 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
