| Identification | |
| Name: | Ethan-d5-ol, carbamate |
| Synonyms: | (2H5 )Ethyl carbamate;Ethan-d5 -ol, carbamate(9CI);Ethyl-d5 Carbamate;Urethane-d5 (ethyl-d5 ); |
| CAS: | 73962-07-9 |
| Molecular Formula: | C3H2D5NO2 |
| Molecular Weight: | 94.12 |
| InChI: | InChI=1/C3H7NO2/c1-2-6-3(4)5/h2H2,1H3,(H2,4,5)/i1D3,2D2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 48.5-50 °C(lit.) |
| Flash Point: | 198 °F |
| Boiling Point: | 182-184 °C(lit.) |
| Density: | 1.104g/cm3 |
| Refractive index: | 1.413 |
| Specification: | Pale Yellow Solid usageEng:Labelled Urethane (U825300). Naturally occurring contaminant in fermented foods, particularly wine, stone-fruit brandies, and bread. This substance is reasonably anticipated to be a human carcinogen. Safety Statements:53-26-36/37/39-45 53:Avoid exposure - obtain special instruction before use 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 198 °F |
| Storage Temperature: | Refrigerator |
| Usage: | Labelled Urethane (U825300). Naturally occurring contaminant in fermented foods, particularly wine, stone-fruit brandies, and bread. This substance is reasonably anticipated to be a human carcinogen. |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
