Identification |
Name: | 2(1H)-Quinolinone,6-[4-(1-cyclohexyl-1H-tetrazol-5-yl)butoxy]- |
Synonyms: | 3,4-Dehydrocilostazol;OPC 13015 |
CAS: | 73963-62-9 |
Molecular Formula: | C20H25 N5 O2 |
Molecular Weight: | 367.44 |
InChI: | InChI=1/C20H25N5O2/c26-20-12-9-15-14-17(10-11-18(15)21-20)27-13-5-4-8-19-22-23-24-25(19)16-6-2-1-3-7-16/h9-12,14,16H,1-8,13H2,(H,21,26) |
Molecular Structure: |
|
Properties |
Flash Point: | 362.594°C |
Boiling Point: | 675.937°C at 760 mmHg |
Density: | 1.342g/cm3 |
Refractive index: | 1.676 |
Specification: | Off-White to Beige Solid usageEng:A metabolite of Cilostazol |
Flash Point: | 362.594°C |
Usage: | A metabolite of Cilostazol |
Safety Data |
|
|