| Identification | |
| Name: | 2-[(4S)-2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate |
| Synonyms: | (S)-2,2-Dimethyl-5-oxo-1,3-dioxolane-4-acetic acid;1,3-dioxolane-4-acetic acid, 2,2-dimethyl-5-oxo-, (4S)-;[(4S)-2,2-Dimethyl-5-oxo-1,3-dioxolan-4-yl]acetic acid;(S)-[2,2-Dimethyl-5-oxodioxolan-4-yl]acetic acid; |
| CAS: | 73991-95-4 |
| Molecular Formula: | C7H10O5 |
| Molecular Weight: | 174.15 |
| InChI: | InChI=1/C7H10O5/c1-7(2)11-4(3-5(8)9)6(10)12-7/h4H,3H2,1-2H3,(H,8,9)/p-1/t4-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 105-112 °C(lit.) |
| Flash Point: | 143.7°C |
| Boiling Point: | 341.4°C at 760 mmHg |
| Density: | 1.262 g/cm3 |
| Appearance: | White solid |
| Specification: | White Solid usageEng:An optically active inhibitor Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 143.7°C |
| Storage Temperature: | -20?C Freezer |
| Usage: | An optically active inhibitor |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
