| Identification | |
| Name: | 1H-Indazole-5,6-diamine |
| Synonyms: | 1H-Indazole,5,6-diamino- (8CI); 5,6-Diaminoindazole; NSC 400122 |
| CAS: | 7404-68-4 |
| EINECS: | 231-012-6 |
| Molecular Formula: | C7H8 N4 |
| Molecular Weight: | 148.16522 |
| InChI: | InChI=1/C7H8N4/c8-5-1-4-3-10-11-7(4)2-6(5)9/h1-3H,8-9H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 256°C |
| Boiling Point: | 449.3°C at 760 mmHg |
| Density: | 1.486g/cm3 |
| Stability: | Light Sensitive |
| Refractive index: | 1.865 |
| Specification: | Light Brown Powder usageEng:Reacts with aldehydes to produce highly fluorescent imidazole derivatives. A fluorometric labeling reagent |
| Flash Point: | 256°C |
| Usage: | Reacts with aldehydes to produce highly fluorescent imidazole derivatives. A fluorometric labeling reagent |
| Safety Data | |
 |
|
