| Identification | |
| Name: | Sethoxydim |
| Synonyms: | 2-[1-(Ethoxyimino)butyl]-5-[2-(ethylthio)propyl]-3-hydroxy-2-cyclohexen-1-one;Alloxol S;BAS 9052;Cyethoxydim;Expand;Expand Plus;Fervinal;Fervinal plus;Grasidim;NP 55;Nabu;Nabu S;Poast;Poast Plus;Sertin; |
| CAS: | 74051-80-2 |
| EINECS: | 277-682-3 |
| Molecular Formula: | C17H29NO3S |
| Molecular Weight: | 327.48 |
| InChI: | InChI=1/C17H29NO3S/c1-5-8-14(18-21-6-2)17-15(19)10-13(11-16(17)20)9-12(4)22-7-3/h12-13,19H,5-11H2,1-4H3/b18-14+ |
| Molecular Structure: | ![(C17H29NO3S) 2-[1-(Ethoxyimino)butyl]-5-[2-(ethylthio)propyl]-3-hydroxy-2-cyclohexen-1-one;Alloxol S;BAS 9052;Cye...](https://img.guidechem.com/casimg/74051-80-2.gif) |
| Properties | |
| Density: | 1.043 |
| Refractive index: | 1.534 |
| Solubility: | Slightly soluble in water; miscible with acetone, benzene, ethyl acetate, n-hexane and alcohol |
| Appearance: | Oily odorless liquid |
| Specification: |
? Sethoxydim , with CAS number of 74051-80-2, can be called (+-)-(ZE)-2-(1-Ethoxyiminobutyl)-5-(2-(ethylthio)propyl)-3- |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
