| Identification | |
| Name: | Benzenamine,2-chloro-6-nitro-3-phenoxy- |
| Synonyms: | 2-Chloro-6-nitro-3-phenoxyaniline;2-Chloro-6-nitro-3-phenoxybenzenamine; Aclonifen; Bandren; Bandur; CME 127; KUB3359 |
| CAS: | 74070-46-5 |
| EINECS: | 277-704-1 |
| Molecular Formula: | C12H9 Cl N2 O3 |
| Molecular Weight: | 264.67 |
| InChI: | InChI=1/C12H9ClN2O3/c13-11-10(18-8-4-2-1-3-5-8)7-6-9(12(11)14)15(16)17/h1-7H,14H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Flash Point: | 172.4°C |
| Density: | 1.422g/cm3 |
| Refractive index: | 1.656 |
| Water Solubility: | 2.5 mg l-1 |
| Solubility: | 2.5mgl-1 |
| Specification: |
2-Chloro-6-nitro-3-phenoxyaniline with CAS registry number of 74070-46-5 is also known as Aclonifen ; Aclonifen [BSI:ISO] ; Benzenamine, 2-chloro-6-nitro-3-phenoxy- ; 2-Chloro-6-nitro-3-phenoxybenzenamine ; Bandur ; CME 127 ; Challenge . It is protoporphyrin oxidase inhibitor, diphenyl ether herbicide. |
| Flash Point: | 172.4°C |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
