| Identification |
| Name: | 3,3'-Diaminobenzidine tetrahydrochloride |
| CAS: | 7411-49-6 |
| EINECS: | 231-018-9 |
| Molecular Formula: | C12H14N4?4(HCl) |
| Molecular Weight: | 360.11 |
| InChI: | InChI=1/C12H14N4.4ClH/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8;;;;/h1-6H,13-16H2;4*1H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3316 9/PG 2 |
| Flash Point: | 282.7°C |
| Boiling Point: | 481.7°C at 760 mmHg |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | Soluble |
| Solubility: | Soluble in water |
| Appearance: | Gray to purple-brown powder. |
| Flash Point: | 282.7°C |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive/Air Sensitive |
| Usage: | A substrate for peroxidase, and a reagent for the spectrophotometric determination of selenium |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
