| Identification | |
| Name: | 3-Pyridinol, 5-chloro- |
| Synonyms: | 3-Chloro-5-hydroxypyridine;3-Chloropyridin-5-ol;3-Hydroxy-5-chloropyridine;5-Chloro-3-hydroxypyridine;3-Chloro-5-hydroxypyridine;5-chloropyridin-3-ol; |
| CAS: | 74115-12-1 |
| EINECS: | 277-727-7 |
| Molecular Formula: | C5H4ClNO |
| Molecular Weight: | 129.54 |
| InChI: | InChI=1/C5H4ClNO/c6-4-1-5(8)3-7-2-4/h1-3,8H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.392 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.583 |
| Appearance: | off-white crystals |
| Specification: |
It is stable under normal temperatures and pressures.It should avoid incompatible materials such as strong Oxidizing agents , strong acids .Its hazardous decomposition products is Hydrogen chloride , Nitrogen oxides , Carbon monoxide , Carbon dioxide . |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
