| Identification | |
| Name: | 4H-Indol-4-one,3-ethyl-1,5,6,7-tetrahydro-2-methyl-5-(4-morpholinylmethyl)- |
| Synonyms: | Indol-4(5H)-one,3-ethyl-6,7-dihydro-2-methyl-5-(morpholinomethyl)- (7CI,8CI);3-Ethyl-6,7-dihydro-2-methyl-5-(morpholinomethyl)indol-4(5H)-one;Molindone; |
| CAS: | 7416-34-4 |
| Molecular Formula: | C16H24N2O2 |
| Molecular Weight: | 276.37 |
| InChI: | InChI=1/C16H24N2O2/c1-3-13-11(2)17-14-5-4-12(16(19)15(13)14)10-18-6-8-20-9-7-18/h12,17H,3-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 180 - 181 |
| Density: | 1.14 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.559 |
| Water Solubility: | H2O: 19 mg/mL |
| Solubility: | H2O: 19 mg/mL |
| Appearance: | off-white solid |
| Specification: |
4H-Indol-4-one,3-ethyl-1,5,6,7-tetrahydro-2-methyl-5-(4-morpholinylmethyl)- , its cas register number is 7416-34-4. It also can be called (+-)-Molindone ; 3-Ethyl-1,5,6,7-tetrahydro-2-methyl-5-(4-morpholinylmethyl)-4H-indol-4-one ; 3-Ethyl-6,7-dihydro-2-methyl-5-(morpholinomethyl)indol-4(5H)-one ; HSDB 3131 ; Indol-4(5H)-one, 3-ethyl-6,7-dihydro-2-methyl-5-(morpholinomethyl)- ; Molindona ; Molindone ; Molindonum ; UNII-RT3Y3QMF8N . 4H-Indol-4-one,3-ethyl-1,5,6,7-tetrahydro-2-methyl-5-(4-morpholinylmethyl)- (CAS NO.7416-34-4) is harmful if swallowed. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | off-white |
| Usage: | Medication. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
