| Identification | |
| Name: | 2-Thiophenemethanol,5-chloro- |
| Synonyms: | (5-Chloro-2-thienyl)methanol;(5-Chlorothiophen-2-yl)methanol; 5-Chloro-2-thiophenemethanol |
| CAS: | 74168-69-7 |
| Molecular Formula: | C5H5 Cl O S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H5ClOS/c6-5-2-1-4(3-7)8-5/h1-2,7H,3H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 92.8°C |
| Boiling Point: | 229.9°C at 760 mmHg |
| Density: | 1.419g/cm3 |
| Refractive index: | 1.603 |
| Specification: |
The 5-Chloro-2-thiophenemethanol with the cas number 74168-69-7, is also called (5-chlorothiophen-2-yl)methanol .The properties of this chemical are: (1)#H bond acceptors: 1 ; (2)#H bond donors: 1 ; (3)#Freely Rotating Bonds: 2 ; (4)Polar Surface Area: 48.47 Å2 ; (5)Index of Refraction: 1.603 ; (6)Molar Refractivity: 35.98 cm3 ; (7)Molar Volume: 104.6 cm3 ; (8)Polarizability: 14.26×10-24cm3 ; (9)Surface Tension: 51 dyne/cm ; (10)Enthalpy of Vaporization: 49.3 kJ/mol ; (11)Vapour Pressure: 0.0381 mmHg at 25°C. The product can be supplied by the following suppliers: (1)New Energy Chemicals ; (2)Nanjing Habo Medical Technology Co., Ltd. ; (3)Nanjing Pharmatechs Co., Ltd.; (4)Nanjing Chemlin Chemical Co., Ltd.; (5)D-L Chiral Chemicals, LLC; (6)Eurolabs Limited; (7)Tractus Company Limited. You can still convert the following datas into molecular structure : |
| Flash Point: | 92.8°C |
| Safety Data | |
 |
|
