| Identification | |
| Name: | 2-Naphthylmethyl radical |
| Synonyms: | 2-METHYLNAPHTHALENE;beta-Methylnaphthalene;Naphthalene, 2-methyl-;91-57-6;.beta.-Methylnaphthalene;Naphthalene, beta-methyl-;2-methylnaphthalen;CHEBI:50720;beta-methyl naphthalenes;HSDB 5274;NSC 3575;EINECS 202-078-3;NAPHTALENE,2-METHYL MFC11 H10;AI3-17554;2-methyl-naphthalene;2-Naphthylmethyl radical;AC1L1NWJ;AC1Q1GKJ;bmse000537;2-Methylnaphthalene (beta);M57006_ALDRICH;442359_SUPELCO;45796_RIEDEL;CHEMBL195895;WLN: L66J C1;45796_FLUKA;67890_FLUKA;NSC3575;NSC-3575;AC-615;AR-1E4048;SBB060085;ZINC01666853;AKOS000120035;LS-1922;NCGC00091415-01;NCGC00091415-02;AB1003413;TR-030801;M0372;C14098;I14-6945;InChI=1/C11H10/c1-9-6-7-10-4-2-3-5-11(10)8-9/h2-8H,1H;7419-61-6 |
| CAS: | 7419-61-6 |
| Molecular Formula: | C11H10 |
| Molecular Weight: | 142.1971 |
| InChI: | InChI=1S/C11H10/c1-9-6-7-10-4-2-3-5-11(10)8-9/h2-8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 37-38 deg C |
| Flash Point: | 97.8°C |
| Boiling Point: | 239.9°Cat760mmHg |
| Density: | 1.016g/cm3 |
| Solubility: | Miscible with alcohol and ether Sol in benzene In water, 24.6 mg/l @ 25 deg C |
| Flash Point: | 97.8°C |
| Color: | Solid or crystalline |
| Safety Data | |
 |
|
