Identification |
Name: | 1-Azetidinebutanoicacid, 2-carboxy-a-[[(3S)-3-carboxy-3-hydroxypropyl]amino]-,(aS,2S)- |
Synonyms: | 1-Azetidinebutanoicacid, 2-carboxy-a-[(3-carboxy-3-hydroxypropyl)amino]-,[2S-[1[aR*(R*)],2R*]]-;2'-Dehydroxymugineic acid; 2'-Deoxymugineic acid |
CAS: | 74235-24-8 |
Molecular Formula: | C12H20 N2 O7 |
Molecular Weight: | 0 |
InChI: | InChI=1/C12H20N2O7/c15-9(12(20)21)1-4-13-7(10(16)17)2-5-14-6-3-8(14)11(18)19/h7-9,13,15H,1-6H2,(H,16,17)(H,18,19)(H,20,21)/t7-,8-,9-/m0/s1 |
Molecular Structure: |
![(C12H20N2O7) 1-Azetidinebutanoicacid, 2-carboxy-a-[(3-carboxy-3-hydroxypropyl)amino]-,[2S-[1[aR*(R*)],2R*]]-;2'-D...](https://img1.guidechem.com/chem/e/dict/51/74235-24-8.jpg) |
Properties |
Flash Point: | 348.8°C |
Boiling Point: | 653.1°C at 760 mmHg |
Density: | 1.468g/cm3 |
Refractive index: | 1.578 |
Flash Point: | 348.8°C |
Usage: | Phytosiderophores are produced in higher plants as iron chelating amino acids that promote uptake of iron from soil |
Safety Data |
|
 |