| Identification | |
| Name: | Propanoic acid,3-bromo-2-oxo-, methyl ester |
| Synonyms: | Pyruvicacid, bromo-, methyl ester (6CI,7CI,8CI); Methyl 3-bromo-2-oxopropanoate;Methyl bromopyruvate; NSC 526776 |
| CAS: | 7425-63-0 |
| Molecular Formula: | C4H5 Br O3 |
| Molecular Weight: | 180.98 |
| InChI: | InChI=1/C4H5BrO3/c1-8-4(7)3(6)2-5/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 125 °C |
| Boiling Point: | 186.8°C at 760 mmHg |
| Density: | 1.7 |
| Refractive index: | 1.480 |
| Specification: |
Methyl bromopyruvate (7425-63-0) can be soluble in many organic solvents which is also called for Methyl 3-bromo-2-oxopropanoate ; 2-Oxo-3-bromopropionic acid methyl ester ; 3-Bromo-2-oxopropionic acid methyl ester . It can be used as pharmaceutical intermediate, pharmaceutical raw material, mainly used to manufacture Thiabendazole . |
| Flash Point: | 125 °C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
