| Identification | |
| Name: | 124-07-2 |
| Synonyms: | CERIUM 2-ETHYLHEXANOATE;CERIUM(III) 2-ETHYLHEXANOATE;Octanoicacid,ceriumsalt;Ceriumethylhexanoate;CERIUMOCTANOATE;Octanoic acid/cerium,(1:x) salt |
| CAS: | 7435-02-1 |
| EINECS: | 231-083-3 |
| Molecular Formula: | C24H45CeO6 |
| Molecular Weight: | 569.7265 |
| InChI: | InChI=1/C8H16O2.Ce/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+3/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | >300 °C(lit.) |
| Flash Point: | 107.4°C |
| Boiling Point: | 239.3°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | Very slightly sol in water (0.068 g/100 g at 20 deg C); freely sol in alcohol, chloroform, ether, carbon disulfide, petroleum ether, glacial acetic acid Miscible in ethanol, chloroform, acetonitrile In water 789 mg/L at 30 deg C |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 107.4°C |
| Color: | SOLIDIFIES TO LEAFY CRYSTALS WHEN COLD Colorless Oily liquid |
| Safety Data | |
 |
|
