Identification |
Name: | 1,2,4-Thiadiazole,5-chloro-3-(chloromethyl)- |
Synonyms: | 3-Chloromethyl-5-chloro-1,2,4-thiadiazole;5-Chloro-3-(chloromethyl)-1,2,4-thiadiazole;NSC 330684; |
CAS: | 74461-64-6 |
Molecular Formula: | C3H2Cl2N2S |
Molecular Weight: | 169.03 |
InChI: | InChI=1/C3H2Cl2N2S/c4-1-2-6-3(5)8-7-2/h1H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 116.8°C |
Boiling Point: | 55°C 1mm |
Density: | 1.609g/cm3 |
Refractive index: | 1.59 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 116.8°C |
Safety Data |
Hazard Symbols |
C: Corrosive
|
|
 |