| Identification | |
| Name: | (S)-(+)-2-Hexyl isocyanate |
| Synonyms: | (S)-(+)-2-HEXYL ISOCYANATE |
| CAS: | 745783-78-2 |
| Molecular Formula: | C7H13NO |
| Molecular Weight: | 127.18 |
| InChI: | InChI=1/C7H13NO/c1-3-4-5-7(2)8-6-9/h7H,3-5H2,1-2H3/t7-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2206 |
| Flash Point: | 46.4°C |
| Boiling Point: | 155.2°C at 760 mmHg |
| Density: | 0.87g/cm3 |
| Refractive index: | 1.44 |
| Specification: | Safety Statements:23-26-36/37/39-45 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 46.4°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
