| Identification | |
| Name: | (S)-(+)-1-(4-Bromophenyl)ethyl isothiocyanate |
| Synonyms: | (S)-(-)-1-(4-BROMOPHENYL)ETHYL ISOTHIOCYANATE |
| CAS: | 745784-02-5 |
| Molecular Formula: | C9H8BrNS |
| Molecular Weight: | 242.14 |
| InChI: | InChI=1/C9H8BrNS/c1-7(11-6-12)8-2-4-9(10)5-3-8/h2-5,7H,1H3/t7-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 145.1°C |
| Boiling Point: | 316.2°C at 760 mmHg |
| Density: | 1.44 |
| Refractive index: | 1.596 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 145.1°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
