Specification: |
The cas register number of Ethyl beta-D-thioglucoside is 7473-36-1. It also can be called as b-D-Glucopyranoside, ethyl 1-thio- and the IUPAC Name about this chemical is 2-ethylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol. It belongs to the following product categories, such as Carbohydrates, Carbohydrates A to, Carbohydrates D-FBiochemicals and Reagents, Monosaccharide and so on.
Physical properties about Ethyl beta-D-thioglucoside are: (1)ACD/LogP: -1.36; (2)#H bond acceptors: 5; (3)#H bond donors: 4; (4)#Freely Rotating Bonds: 7; (5)Polar Surface Area: 71.45Å2; (6)Index of Refraction: 1.592; (7)Molar Refractivity: 52.82 cm3; (8)Molar Volume: 156 cm3; (9)Polarizability: 20.94x10-24cm3; (10)Surface Tension: 69.9 dyne/cm; (11)Enthalpy of Vaporization: 80.56 kJ/mol; (12)Vapour Pressure: 1.28E-09 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: S(CC)C1OC(C(O)C(O)C1O)CO
(2)InChI: InChI=1/C8H16O5S/c1-2-14-8-7(12)6(11)5(10)4(3-9)13-8/h4-12H,2-3H2,1H3
(3)InChIKey: CHAHFVCHPSPXOE-UHFFFAOYAP
(4)Std. InChI: InChI=1S/C8H16O5S/c1-2-14-8-7(12)6(11)5(10)4(3-9)13-8/h4-12H,2-3H2,1H3
(5)Std. InChIKey: CHAHFVCHPSPXOE-UHFFFAOYSA-N
|