| Identification | |
| Name: | lauric acid, compound with 2,2'-iminodiethanol (1:1) |
| Synonyms: | Lauric acid diethanolamine salt;Diethanolamine laurate;Diethanolamine monolaurate;Dodecanoic acid, compd with 2,2'-iminobis(ethanol) (1:1);HSDB 4193;Lauric acid, compd with 2,2'-iminodiethanol (1:1);Lauric diethanolamine;Dodecanoic acid, compd. with 2,2'-iminobis(ethanol) (1:1);Lauric acid, compound with 2,2'-iminodiethanol (1:1);dodecanoic acid - 2,2'-iminodiethanol (1:1) |
| CAS: | 7487-79-8 |
| EINECS: | 231-297-7 |
| Molecular Formula: | C16H35NO4 |
| Molecular Weight: | 305.4534 |
| InChI: | InChI=1/C12H24O2.C4H11NO2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;6-3-1-5-2-4-7/h2-11H2,1H3,(H,13,14);5-7H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 134.1°C |
| Boiling Point: | 296.1°C at 760 mmHg |
| Flash Point: | 134.1°C |
| Safety Data | |
 |
|
