| Identification | |
| Name: | 2,6-Octadiene,1,1-diethoxy-3,7-dimethyl- |
| Synonyms: | 2,6-Octadienal,3,7-dimethyl-, diethyl acetal (8CI); Citral diethyl acetal (6CI);1,1-Diethoxy-3,7-dimethylocta-2,6-diene |
| CAS: | 7492-66-2 |
| EINECS: | 231-323-7 |
| Molecular Formula: | C14H26 O2 |
| Molecular Weight: | 226.35504 |
| InChI: | InChI=1S/C14H26O2/c1-6-15-14(16-7-2)11-13(5)10-8-9-12(3)4/h9,11,14H,6-8,10H2,1-5H3/b13-11+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Density: | 0.875 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. May be sensitive to moisture. |
| Refractive index: | 1.449 |
| Water Solubility: | negligible |
| Solubility: | negligible |
| Appearance: | colourless liquid |
| Specification: |
Citral diethylacetal ,its CAS NO. is 7492-66-2,the synonyms is 1,1-Diethoxy-3,7-dimethyl-6-octadiene ; 6-Octadienal,3,7-dimethyl-diethylacetal ; 6-Octadiene,1,1-diethoxy-3,7-dimethyl-2 ; Citral diethyl acetal ; Citral-diethylacetal 'r' ; Fema 2304 ; 3,7-Dimethyl-2,6-octadienal diethyl acetal ; 1,1-Diethoxy-3,7-dimethyl-2,6-octadiene . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
 |
|
